S5796830
≥98%(HPLC) , 53882-12-5
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB779.52 | In Stock |
|
| 25mg | RMB2924.22 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212° (dec) |
| Density | 1.78±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMF: 3 mg/ml; DMSO: 5 mg/ml; PBS (pH 7.2): 2 mg/mL |
| form | A solid |
| pka | 2.07±0.50(Predicted) |
| color | Off-white to pink |
| Stability: | Hygroscopic |
| InChI | 1S/C11H6ClN3O6/c12-7-5(14-8(16)10(18)19)1-4(3-13)2-6(7)15-9(17)11(20)21/h1-2H,(H,14,16)(H,15,17)(H,18,19)(H,20,21) |
| InChIKey | RVGLGHVJXCETIO-UHFFFAOYSA-N |
| SMILES | Clc1c(cc(cc1NC(=O)C(=O)O)C#N)NC(=O)C(=O)O |
Description and Uses
Trometamol (2-amino-2-(hydroxymethyl)-1,3- propanediol) salt . Lodoxamide is an antiallergic drug acting as a mast-cell stabilizer, which is effective in the treatment of allergic conjunctivitis .
Harmful
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
