S5807751
3-HYDROXYESTRA-1,3,5(10),7-TETRAEN-17-ONE , AldrichCPR
Synonym(s):
1,3,5(10),7-Estratetraen-3-ol-17-one;3-Hydroxy-1,3,5(10),7-estratetraen-17-one;7-Dehydroestrone
CAS NO.:
Empirical Formula: C18H20O2
Molecular Weight: 268.35
MDL number: MFCD00046223
EINECS: 207-488-6
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB117.90 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238-240 °C(lit.) |
| alpha | D25 +308° (c = 2 in dioxane); D25 +325° (c = 2 in alc) |
| Boiling point: | 351.51°C (rough estimate) |
| Density | 1.1096 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| Flash point: | 9℃ |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Dioxane (Slightly, Heated, Sonicated), DMSO (Slightly, Sonicated) |
| form | Solid |
| pka | pKa 10.26±0.04(H2O t=23±2) (Uncertain) |
| color | White to off-white |
| optical activity | +28725 (1% in dioxane) |
| Water Solubility | 1.4mg/L(25 ºC) |
| Merck | 13,3672 |
| BRN | 2624302 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C18H20O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3-5,10,14,16,19H,2,6-9H2,1H3/t14-,16+,18+/m1/s1 |
| InChIKey | WKRLQDKEXYKHJB-HFTRVMKXSA-N |
| SMILES | C[C@]12CC[C@H]3C(=CCc4cc(O)ccc34)[C@@H]1CCC2=O |
| EPA Substance Registry System | Equilin (474-86-2) |
Description and Uses
Equilin is an estrogen found in Premarin, which is a mixture of conjugated estrogens widely used in hormone replacement therapy.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H351-H361fd-H362 |
| Precautionary statements | P202-P260-P263-P264-P270-P308+P313 |
| Hazard Codes | Xn,T,F |
| Risk Statements | 40-62-63-39/23/24/25-23/24/25-11 |
| Safety Statements | 36/37-45-16-7 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 3 |
| RTECS | KG6650000 |
| HS Code | 2937230000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Lact. Repr. 2 |






