A8433832
cis-(Z)-Flupentixol Dihydrochloride , ≥98%(HPLC) , 51529-01-2
Synonym(s):
(Z)-4-[3-[2-(Trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]-1-piperazineethanol dihydrochloride;Flupentixol dihydrochloride
CAS NO.：51529-01-2
Empirical Formula: C23H26ClF3N2OS
Molecular Weight: 470.98
MDL number: MFCD00069278
EINECS: 637-103-0
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB79.20 | In Stock |
|
| 50mg | RMB239.20 | In Stock |
|
| 250MG | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-202°C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | H2O: soluble |
| form | solid |
| color | white to off-white |
| Water Solubility | H2O: soluble |
| InChI | 1S/C23H25F3N2OS.2ClH/c24-23(25,26)17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)30-22)5-3-9-27-10-12-28(13-11-27)14-15-29;;/h1-2,4-8,16,29H,3,9-15H2;2*1H/b18-5-;; |
| InChIKey | IOVDQEIIMOZNNA-MHKBYHAFSA-N |
| SMILES | Cl[H].Cl[H].OCCN1CCN(CC\C=C2\c3ccccc3Sc4ccc(cc24)C(F)(F)F)CC1 |
Description and Uses
cis-(Z)-Flupenthixol dihydrochloride has been used in drug infusions. It has been used to determine the causal involvement of extracellular LS-DA and LS-NE release patterns on social play behavior.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | TL9900000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
