S5879549
Piperidine-d11 , 98atom%D , 143317-90-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2749.06 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -13 °C (lit.) |
| Boiling point: | 106 °C (lit.) |
| Density | 0.973 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 40 °F |
| InChI | InChI=1S/C5H11N/c1-2-4-6-5-3-1/h6H,1-5H2 |
| InChIKey | NQRYJNQNLNOLGT-UHFFFAOYSA-N |
| SMILES | C1([H])([H])C([H])([H])C([H])([H])N([H])C([H])([H])C1([H])[H] |
| CAS Number Unlabeled | 110-89-4 |
Description and Uses
Labeled PIPERIDINE-D11, intended for use as an internal standard for the quantification of piperidine by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H225-H302-H311+H331-H314-H412 |
| Precautionary statements | P210-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24-34 |
| Safety Statements | 16-26-27-45 |
| RIDADR | UN 2401 8/PG 1 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B |






