PRODUCT Properties
| Melting point: | 310 °C(lit.) |
| Boiling point: | 533.5±30.0 °C(Predicted) |
| Density | 1.318±0.06 g/cm3(Predicted) |
| pka | 4.15±0.10(Predicted) |
| form | solid |
| InChI | 1S/C17H16O6/c18-16(19)12-2-6-14(7-3-12)22-10-1-11-23-15-8-4-13(5-9-15)17(20)21/h2-9H,1,10-11H2,(H,18,19)(H,20,21) |
| InChIKey | VBISQLWPGDULSX-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(OCCCOc2ccc(cc2)C(O)=O)cc1 |
Description and Uses
Building block for polyanhydrides, a class of bioerodible polymer with drug delivery applications.1,2
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H400 |
| Precautionary statements | P273-P280-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Skin Sens. 1 |
