S5906049
2,2′-Dipyridyl-d8 , 98atom%D , 32190-42-4
Synonym(s):
2,2′-Bipyridyl-d8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB7879.26 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-73 °C(lit.) |
| Boiling point: | 273 °C(lit.) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C10H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| InChIKey | ROFVEXUMMXZLPA-PGRXLJNUSA-N |
| SMILES | C1(N=C(C([2H])=C([2H])C=1[2H])[2H])C1N=C(C([2H])=C([2H])C=1[2H])[2H] |
Description and Uses
2,2''-Bipyridyl-d8 was a useful compound in the NMR study of soft porous nanocrystal and a bulk crystal.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
