S5951951
98% , 28009-80-5
Synonym(s):
Di-tert-butyl 3-oxoglutarate
CAS NO.:28009-80-5
Empirical Formula: C13H22O5
Molecular Weight: 258.31
MDL number: MFCD00010184
EINECS: 248-775-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB8320.69 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-60 °C (lit.) |
| storage temp. | 2-8°C |
| solubility | methanol: soluble1g/10 mL, clear, colorless to faintly yellow |
| form | solid |
| Appearance | Off-white to light yellow Solid |
| BRN | 2272995 |
| InChI | 1S/C13H22O5/c1-12(2,3)17-10(15)7-9(14)8-11(16)18-13(4,5)6/h7-8H2,1-6H3 |
| InChIKey | KREDQIDLGFBDMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(=O)CC(=O)OC(C)(C)C |
Description and Uses
Di-tert-butyl 1,3-acetonedicarboxylate was used in the synthesis of di-tert-butyl 2,3-pentadienedioate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 21 |
| Storage Class | 11 - Combustible Solids |






