S5978249
AldrichCPR , 85179-91-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB117.90 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69 °C |
| Density | 0.836 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 9 °C |
| storage temp. | 2-8°C |
| form | liquid |
| BRN | 3537135 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C13H22/c1-12(2,3)10-7-8-11(9-10)13(4,5)6/h7-10H,1-6H3 |
| InChIKey | RADVPPBTEASJRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1C=CC(=C1)C(C)(C)C |
Description and Uses
Di-tert-butylcyclopentadiene may be used in the preparation of 2,5,4′,6′-tetra-tert-butyl-5′H-spirocyclopentane-1,2′-cyclopenta[b][1,3]diselena-2,4-diene and 1,3,5,7-tetra-tert-butyl-3a,7a-dihydro-3a,7a-epi-selenodicyclopenta[b,e][1,4]diselenine.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 3295 3/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |





