S599678
(R)-(+)-Bornylamine , 97% , 32511-34-5
Synonym(s):
(+)-Bornanamine;endo-(1R)-1,7,7-Trimethylbicyclo[2.2.1]heptan-2-amine
CAS NO.:32511-34-5
Empirical Formula: C10H19N
Molecular Weight: 153.26
MDL number: MFCD00042691
EINECS: 251-076-9
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB462.52 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-163 °C(lit.) |
| Boiling point: | 189 ºC |
| Density | 0.923 |
| refractive index | 1.4600 (estimate) |
| Flash point: | 48 ºC |
| storage temp. | 2-8°C |
| form | Powder or Waxy Solid |
| pka | 11.01±0.60(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D +46±2°, c = 0.5% in ethanol |
| BRN | 2801831 |
| InChI | 1S/C10H19N/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8H,4-6,11H2,1-3H3/t7-,8+,10+/m1/s1 |
| InChIKey | MDFWXZBEVCOVIO-WEDXCCLWSA-N |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](N)C2 |
| CAS DataBase Reference | 32511-34-5(CAS DataBase Reference) |
Description and Uses
(R)-(+)-Bornylamine in the presence of acetonitrile as a solvent and tetraethylammonium bromide as the bromide ion source, may be used in the crystallization-induced chiral inversion of (S)-2-bromo-3-phenylpropanoic acid to its (R)-enantiomer. It may also be used to synthesize trans-bis{(R)-(+)-bornylamino}palladium(II) dichloride, a palladium(II) complex with potent antitumor activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3259 |
| WGK Germany | 3 |
| F | 10-34 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29213000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





