PRODUCT Properties
| Melting point: | 114-116 °C (lit.) |
| Boiling point: | 315.5±42.0 °C(Predicted) |
| Density | 1.398±0.06 g/cm3(Predicted) |
| pka | 11.85±0.46(Predicted) |
| InChI | 1S/C10H12BrNO2/c1-6-4-8(14-10(13)12-3)5-7(2)9(6)11/h4-5H,1-3H3,(H,12,13) |
| InChIKey | ZOZFMTULOYRWEL-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cc(C)c(Br)c(C)c1 |
Description and Uses
4-Bromo-3,5-dimethylphenyl N-methylcarbamate (BDMC) may be employed as internal standard:
- for the quantification of carbamate pesticides in water samples using solid phase microextraction combined with gas chromatography-triple quadrupole mass spectrometry
- during the LC-MS-MS analysis of N-methyl carbamate pesticide residues in vegetables and grains
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
