S6041949
Tin , foil,2mcoil,thickness0.096mm,coilwidth41mm,asrolled,99.95% , 7440-31-5
Synonym(s):
M6G
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237-240°C (dec.) |
| Boiling point: | 731.6±60.0 °C(Predicted) |
| Density | 1?+-.0.1 g/cm3(Predicted) |
| Flash point: | 24℃ |
| storage temp. | −20°C |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Heated), Water (Slightly) |
| form | Solid |
| pka | 2.79±0.70(Predicted) |
| color | White to Pale Beige |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology |
| InChIKey | GNJCUHZOSOYIEC-GAROZEBRSA-N |
| SMILES | CN1CC[C@]23[C@H]4Oc5c(O)ccc(C[C@@H]1[C@@H]2C=C[C@@H]4O[C@@H]6O[C@@H]([C@@H](O)[C@H](O)[C@H]6O)C(O)=O)c35 |
Description and Uses
Controlled Substance. Major metabolite of Morphine that is a potent opioid receptor agonist. Analgesic (narcotic)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H317 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| target organs | Eyes |
| Hazard Codes | Xn,T |
| Risk Statements | 20/21/22-43-39/23/24/25-10-23/24/25 |
| Safety Statements | 36-36/37-45 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | 3 |
| RTECS | LZ6500700 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 3 STOT SE 1 |


