S6066849
L-Tyrosine-1-13C , ≥99atom%13C,≥98%(CP) , 110622-46-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB14519.14 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (dec.)(lit.) |
| form | Solid |
| color | White to off-white |
| optical activity | [α]20/D -10.6°, c = 4 in 1 M HCl |
| InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i8+1,10+1 |
| InChIKey | OUYCCCASQSFEME-OIWRJEPOSA-N |
| SMILES | OC1=CC=C(C[13C@H]([15NH2])C(O)=O)C=C1 |
| CAS Number Unlabeled | 60-18-4 |
Description and Uses
L-Tyrosine-13C is the 13C-labeled L-Tyrosine. L-Tyrosine is a non-essential amino acid which can inhibit citrate synthase activity in the posterior cortex.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
