PRODUCT Properties
| Melting point: | 119-123 °C(lit.) |
| Boiling point: | 537.2±50.0 °C(Predicted) |
| Density | 1.375 |
| solubility | Chloroform (Sparingly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 11.44±0.70(Predicted) |
| color | White to Off-White |
| InChI | 1S/C15H11Cl2NO2/c16-9-14(19)18-13-7-6-11(17)8-12(13)15(20)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19) |
| InChIKey | HDXLZRWEZZFDKA-UHFFFAOYSA-N |
| SMILES | ClCC(=O)Nc1ccc(Cl)cc1C(=O)c2ccccc2 |
| CAS DataBase Reference | 4016-85-7(CAS DataBase Reference) |
Description and Uses
Intermediate in the preparation of Alprazolam impurities.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 1759 8/PG 3 |
| WGK Germany | 3 |
| RTECS | AB4542650 |
| HS Code | 2924190090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |




![N'-[[(2-benzoyl-4-chlorophenyl)(chloroacetyl)amino]methylene]chloroacetohydrazide](https://img.chemicalbook.com/CAS/GIF/49691-65-8.gif)
