S6087649
D-Histidinoldihydrochloride , 98% , 75614-84-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1482.52 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195 °C(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D +3°, c = 1 in H2O |
| Major Application | peptide synthesis |
| InChI | 1S/C6H11N3O.2ClH/c7-5(3-10)1-6-2-8-4-9-6;;/h2,4-5,10H,1,3,7H2,(H,8,9);2*1H/t5-;;/m1../s1 |
| InChIKey | FRCAFNBBXRWXQA-ZJIMSODOSA-N |
| SMILES | Cl.Cl.N[C@@H](CO)Cc1c[nH]cn1 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36/37-22 |
| WGK Germany | 3 |
| HS Code | 29331190 |
| Storage Class | 11 - Combustible Solids |
