S609579
contains≤200 ppmMEHQasinhibitor,99%(GC) , 86112-79-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB967.82 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-103°C |
| Boiling point: | 472.2±14.0 °C(Predicted) |
| Density | 1.237±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly) |
| form | powder |
| Appearance | Off-White to Pale Yellow Solid |
| InChI | InChI=1S/C21H16O2/c1-13(2)21(22)23-12-17-9-8-16-7-6-14-4-3-5-15-10-11-18(17)20(16)19(14)15/h3-11H,1,12H2,2H3 |
| InChIKey | BUQDPCFXOBQDLX-UHFFFAOYSA-N |
| SMILES | C(OCC1=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1)(=O)C(C)=C |
| CAS DataBase Reference | 86112-79-0 |
Description and Uses
(1-Pyrene)methyl Methacrylate is a fluorescent monomer.
- fluorescent monomer
