S6104149
(1R)-(?)-Dimenthylsuccinate , 99% , 34212-59-4
Synonym(s):
(−)-Di[(1R)-menthyl] succinate
| Pack Size | Price | Stock | Quantity |
| 5g | RMB723.59 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-64 °C (lit.) |
| Boiling point: | 200-205 °C/2 mmHg (lit.) |
| Density | 0.9873 (rough estimate) |
| refractive index | 1.4460 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| Appearance | White to yellow Solid |
| optical activity | [α]20/D 89°, c = 5 in chloroform |
| BRN | 3220135 |
| InChI | 1S/C24H42O4/c1-15(2)19-9-7-17(5)13-21(19)27-23(25)11-12-24(26)28-22-14-18(6)8-10-20(22)16(3)4/h15-22H,7-14H2,1-6H3/t17-,18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | YZXZAUAIVAZWFN-KQFPAPQFSA-N |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)CCC(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C |
| LogP | 8.072 (est) |
Description and Uses
Dimethyl Succinate is used in the synthesis of antifungal agents and synthetic analogues.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
