S6180649
5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione , 99% , 75039-60-0
| Pack Size | Price | Stock | Quantity |
| 10g | RMB2813.42 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-123 °C (lit.) |
| Boiling point: | 360.1±42.0 °C(Predicted) |
| Density | 1.237±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| form | solid |
| pka | 3.28±0.40(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | 1S/C9H13NO4/c1-9(2)13-7(11)6(5-10(3)4)8(12)14-9/h5H,1-4H3 |
| InChIKey | YKMXFLMJEHHKMU-UHFFFAOYSA-N |
| SMILES | CN(C)\C=C1/C(=O)OC(C)(C)OC1=O |
Description and Uses
5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione is a β-dimethyl amino acrylate and its synthesis has been reported.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |