S6197349
4-(Trimethylsiloxy)-3-penten-2-one , 97% , 13257-81-3
Synonym(s):
Acetylacetone enol trimethylsilyl ether;TMS acac
CAS NO.：13257-81-3
Empirical Formula: C8H16O2Si
Molecular Weight: 172.3
MDL number: MFCD00009853
EINECS: 236-252-5
| Pack Size | Price | Stock | Quantity |
| 25g | RMB945.46 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 66-68 °C4 mm Hg(lit.) |
| Density | 0.912 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 58°C |
| storage temp. | 2-8°C |
| Specific Gravity | 0.912 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1759078 |
| InChI | 1S/C8H16O2Si/c1-7(9)6-8(2)10-11(3,4)5/h6H,1-5H3/b8-6+ |
| InChIKey | FBADCSUQBLLAHW-SOFGYWHQSA-N |
| SMILES | CC(=O)\C=C(/C)O[Si](C)(C)C |
| CAS DataBase Reference | 13257-81-3(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Penten-2-one, 4-[(trimethylsilyl)oxy]- (13257-81-3) |
Description and Uses
4-(Trimethylsiloxy)-3-penten-2-one (trimethylsilyl ether of acetylacetone) has been used in the synthesis of isomers of organosilicon carbofunctional compounds:
- 4-(3μ-triethoxysilylpropylimino)pent-2-en-2-ol
- 4-(3μ-triethoxysilylpropylamino)pent-3-en-2-one
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
