PRODUCT Properties
| Melting point: | 143-145 °C (lit.) |
| Boiling point: | 290.67°C (rough estimate) |
| Density | 1.1130 (rough estimate) |
| refractive index | 1.5087 (estimate) |
| form | solid |
| InChI | 1S/C11H14O3/c1-6(2)8-5-4-7(3)10(12)9(8)11(13)14/h4-6,12H,1-3H3,(H,13,14) |
| InChIKey | ZHLQYPNVDAMSFD-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C)c(O)c1C(O)=O |
Description and Uses
2-Hydroxy-6-isopropyl-3-methylbenzoic acid is a multiple-substituted derivative of benzoic acid. Crystal structure of 2-hydroxy-6-isopropyl-3-methylbenzoic acid has been investigated.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | GZ6003000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
