S6247549
Ethylene-d4-diamine , 98atom%D,98%(CP) , 37164-19-5
Synonym(s):
Ethylenediamine-1,1,2,2-d4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB2823.18 | In Stock |
|
| 1g | RMB7044.87 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 9 °C(lit.) |
| Boiling point: | 118 °C(lit.) |
| Density | 1.022 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 93 °F |
| solubility | soluble in Chloroform, Methanol |
| form | Oil |
| color | Clear Colourless to Pale Yellow |
| InChI | 1S/C2H8N2/c3-1-2-4/h1-4H2/i1D2,2D2 |
| InChIKey | PIICEJLVQHRZGT-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(N)C([2H])([2H])N |
| CAS Number Unlabeled | 107-15-3 |
Description and Uses
Isotope labelled Ethylene Diamine(Ethylene-d4 Diamine), a chemical reagent used in the production of various derivatives containing varying functional groups. It is also a known chelating agent. It has also been seen to reduce seizures caused by systematic injection of proconvulsants. It displays antiepileptic and anxiolytic activity.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H302+H312-H314-H317-H334 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 10-21/22-34-42/43 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 1604 8/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Flam. Liq. 3 Resp. Sens. 1B Skin Corr. 1B Skin Sens. 1B |









