S6262949
Triethylphosphonoacetate-13C2 , 99atom%13C , 100940-60-1
Synonym(s):
(Diethoxyphosphinyl)·acetic-13C2 acid ethyl ester;13C Labeled triethyl phosphonoacetate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB6793.56 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 142-145 °C/9 mmHg (lit.) |
| Density | 1.13 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| InChI | 1S/C8H17O5P/c1-4-11-8(9)7-14(10,12-5-2)13-6-3/h4-7H2,1-3H3/i7+1,8+1 |
| InChIKey | GGUBFICZYGKNTD-BFGUONQLSA-N |
| SMILES | CCO[13C](=O)[13CH2]P(=O)(OCC)OCC |
Description and Uses
Triethyl Phosphonoacetate-13C2 is the isotope labelled analog of Triethyl Phosphonoacetate (T777000). Triethyl Phosphonoacetate is a reagent used for Horner-Emmons modification.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H411 |
| Precautionary statements | P264-P273-P280-P305+P351+P338-P337+P313-P391 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 |







