S6262951
99atom%13C , 63346-81-6
Synonym(s):
13C Labeled glycerol;1,2,3-Propanetriol-13C3;Glycerin-13C3
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB5387.84 | In Stock |
|
| 1G | RMB6002.55 | In Stock |
|
| 5G | RMB24872.66 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20 °C (lit.) |
| Boiling point: | 182 °C (lit.) |
| Density | 1.302 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 320 °F(lit.) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Oil |
| color | Colourless |
| Stability: | Hygroscopic |
| InChI | 1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i1+1,2+1,3+1 |
| InChIKey | PEDCQBHIVMGVHV-VMIGTVKRSA-N |
| SMILES | O[13CH2][13CH](O)[13CH2]O |
| CAS Number Unlabeled | 56-81-5 |
Description and Uses
Glycerol is used both in sample preparation and gel formation for polyacrylamide gel electrophoresis. Glycerol (5-10%) increases the density of a sample so that the sample will layer at the bottom of a gel’s sample well. Glycerol is also used to aid in casting gradient gels and as a protein stabilizer and storage buffer component. This is the labeled version.
Safety
| WGK Germany | 1 |
| Storage Class | 10 - Combustible liquids |




