S6329051
MreBPerturbingCompoundA22-CAS22816-60-0-Calbiochem , 22816-60-0
Synonym(s):
MreB Perturbing Compound A22;MreB Perturbing Compound A22 - CAS 22816-60-0 - Calbiochem;S-(3,4-Dichlorobenzyl)isothiourea hydrochloride;S-(3,4-Dichlorobenzyl)isothiourea, HCl
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB1436.38 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210 °C |
| storage temp. | 2-8°C |
| solubility | H2O: soluble2mg/mL (clear solution, warmed) |
| form | White solid |
| color | white to beige |
| Water Solubility | water: 2mg/mL DMSO: 200mg/mL |
| InChI | 1S/C8H8Cl2N2S.ClH/c9-6-2-1-5(3-7(6)10)4-13-8(11)12;/h1-3H,4H2,(H3,11,12);1H |
| InChIKey | VBJNMXMOMSWRDV-UHFFFAOYSA-N |
| SMILES | Cl.NC(=N)SCc1ccc(Cl)c(Cl)c1 |
Description and Uses
MreB Perturbing Compound A22 is an isothiourea that reversibly perturbs MreB function.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2930909899 |
| Storage Class | 11 - Combustible Solids |


