S6372149
98atom%15N,99%(CP) , 106665-75-2
Synonym(s):
N-(tert-Butoxycarbonyl)glycine-15N;15N Labeled Boc-Gly-OH;15N Labeled N-(tert-butoxycarbonyl)glycine;Glycine-15N, N-t-Boc derivative
| Pack Size | Price | Stock | Quantity |
| 1g | RMB4835.49 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-89 °C (lit.) |
| storage temp. | -15°C |
| form | Solid |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | 1S/C7H13NO4/c1-7(2,3)12-6(11)8-4-5(9)10/h4H2,1-3H3,(H,8,11)(H,9,10)/i8+1 |
| InChIKey | VRPJIFMKZZEXLR-VJJZLTLGSA-N |
| SMILES | CC(C)(C)OC(=O)[15NH]CC(O)=O |
| CAS Number Unlabeled | 4530-20-5 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| Storage Class | 11 - Combustible Solids |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






