S6397149
tert-Butyl3,4,5-trimethyl-2-pyrrolecarboxylate , 97% , 50634-31-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB475.02 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-141 °C (lit.) |
| form | chunks |
| InChI | 1S/C12H19NO2/c1-7-8(2)10(13-9(7)3)11(14)15-12(4,5)6/h13H,1-6H3 |
| InChIKey | JPUCLUDOOSRGFH-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(C(=O)OC(C)(C)C)c(C)c1C |
Description and Uses
tert-Butyl 3,4,5-trimethyl-2-pyrrolecarboxylate may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
