PRODUCT Properties
| Melting point: | 138-140 °C (lit.) |
| form | solid |
| InChI | 1S/C14H9FO3/c15-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)14(17)18/h1-8H,(H,17,18) |
| InChIKey | FJAZVXUPZQSZKI-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccccc1C(=O)c2ccc(F)cc2 |
| CAS DataBase Reference | 7649-92-5(CAS DataBase Reference) |
Description and Uses
2-(4-Fluorobenzoyl)benzoic acid was used to prepare starting material for the synthesis of 9-fluoro-7H-benz(de)anthracene-7-one. It was used as starting reagent for the synthesis of Heparan sulfate glycosaminoglycans (HSGAG)-mimetic compounds.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| Storage Class | 11 - Combustible Solids |
