S6419449
2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphineruthenium(II)carbonyl , 41636-35-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1306.63 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| λmax | 391 nm |
| InChIKey | CRTFSNIGJRIMPF-YAJYDHHFSA-N |
| SMILES | [C-]#[O+].CCc1c(CC)c2cc3c(CC)c(CC)c4cc5nc(cc6c(CC)c(CC)c(cc1n2)n6[Ru]n34)c(CC)c5CC |
Description and Uses
2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine ruthenium(II) carbonyl (RuOEP )can form blended polymeric films with poly (3-hexythiopene-2,5-diyl)( P3HT).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






