PRODUCT Properties
| Melting point: | 128-129 °C (lit.) |
| Boiling point: | 524.6±50.0 °C(Predicted) |
| Density | 1.126±0.06 g/cm3(Predicted) |
| pka | 16.00±0.50(Predicted) |
| InChI | 1S/C21H30N2O4/c1-7-14-12(5)18(20(24)26-9-3)22-16(14)11-17-15(8-2)13(6)19(23-17)21(25)27-10-4/h22-23H,7-11H2,1-6H3 |
| InChIKey | BPMQEODKNZPRMH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c(Cc2[nH]c(C(=O)OCC)c(C)c2CC)c(CC)c1C |
Description and Uses
Diethyl 5,5′-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate) may be used as starting reagent for the synthesis of bis-pyrrolylmethane based anion receptors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
