S6470749
Bis(2-isopropoxyphenyl)chlorophosphine , 97% , 1219589-19-1
CAS NO.:1219589-19-1
Empirical Formula: C18H22ClO2P
Molecular Weight: 336.79
MDL number: MFCD16621408
| Pack Size | Price | Stock | Quantity |
| 1g | RMB628.38 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-56°C |
| Boiling point: | 446.8±30.0 °C(Predicted) |
| form | powder |
| InChI | 1S/C18H22ClO2P/c1-13(2)20-15-9-5-7-11-17(15)22(19)18-12-8-6-10-16(18)21-14(3)4/h5-14H,1-4H3 |
| InChIKey | NWXVTDDEQGYXBC-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccccc1P(Cl)c2ccccc2OC(C)C |
Description and Uses
Chlorobis(2-Isopropoxyphenyl)phosphine is a useful intermediate for organic synthesis and other chemical processes.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | 3 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |





