S6499949
2-Chloro-2-methylpropane-d9 , 99atom%D , 918-20-7
Synonym(s):
tert-Butyl-d9 chloride
CAS NO.:918-20-7
Empirical Formula: C4ClD9
Molecular Weight: 101.62
MDL number: MFCD00055681
EINECS: 213-041-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1816.14 | In Stock |
|
| 5g | RMB3681.98 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -25 °C(lit.) |
| Boiling point: | 51-52 °C(lit.) |
| Density | 0.933 g/mL at 25 °C |
| vapor pressure | 5.11 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 65 °F |
| storage temp. | Refrigerator |
| solubility | Chlroform (Soluble), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Stability: | Volatile |
| InChI | InChI=1S/C4H9Cl/c1-4(2,3)5/h1-3H3/i1D3,2D3,3D3 |
| InChIKey | NBRKLOOSMBRFMH-GQALSZNTSA-N |
| SMILES | C(Cl)(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| CAS Number Unlabeled | 507-20-0 |
Description and Uses
Isotope labelled 2-Chloro-2-methylpropane is a starting molecule to carry out nucleophilic substitution reactions.





