S650079
Phosphazene base P2-Et , ≥98.0%(NT) , 165535-45-5
Synonym(s):
1-Ethyl-2,2,4,4,4-pentakis(dimethylamino)-2λ5,4λ5-catenadi(phosphazene);Tetramethyl(tris(dimethylamino)phosphoranylidene)phosphorictriamid-Et-imin
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB1904.79 | In Stock |
|
| 5ml | RMB5472.83 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 96 °C0.05 mm Hg(lit.) |
| Density | 1.02 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 113 °C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| BRN | 7485991 |
| InChI | 1S/C12H35N7P2/c1-12-13-20(15(2)3,16(4)5)14-21(17(6)7,18(8)9)19(10)11/h12H2,1-11H3 |
| InChIKey | CFUKEHPEQCSIOM-UHFFFAOYSA-N |
| SMILES | CCN=P(N=P(N(C)C)(N(C)C)N(C)C)(N(C)C)N(C)C |
Description and Uses
P2Et phosphazene is a strong non-ionic base has the ability to catalyze a wide variety of organic transformations. This includes but is not limited to cross coupling reactions, deprotonation of sulphones and conversion of vinyl sufone to allyl sulfone
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3267 8/PG 2 |
| WGK Germany | 3 |
| F | 3-10-21-34 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |




