S6512449
Fentanylsolution , 1.0 mg/mLinmethanol,ampuleof1 mL,certifiedreferencematerial,Cerilliant , 437-38-7
Synonym(s):
Fentanyl
CAS NO.:437-38-7
Empirical Formula: C22H28N2O
Molecular Weight: 336.47
MDL number: MFCD00661055
EINECS: 207-113-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-84°C |
| Boiling point: | 466℃ |
| Density | 1.087 |
| refractive index | 1.6500 (estimate) |
| Flash point: | 186℃ |
| storage temp. | Controlled Substance, -20°C Freezer |
| solubility | Practically insoluble in water, freely soluble in ethanol (96 per cent) and in methanol |
| pka | 8.4(at 25℃) |
| form | A crystalline solid |
| color | Crystals |
| Water Solubility | 0.2g/L(25 ºC) |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C22H28N2O/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19/h3-12,21H,2,13-18H2,1H3 |
| InChIKey | PJMPHNIQZUBGLI-UHFFFAOYSA-N |
| SMILES | N2(CCC(CC2)N(c3ccccc3)C(=O)CC)CCc1ccccc1 |
| EPA Substance Registry System | Propanamide, N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]- (437-38-7) |
Description and Uses
Used as an analgesic. Controlled Substance
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H336 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| target organs | Central nervous system |
| Hazard Codes | F,T |
| Risk Statements | 11-23/25-36/38-39/23/24/25-23/24/25 |
| Safety Statements | 16-24-45-36/37-7 |
| RIDADR | 1544 |
| WGK Germany | 2 |
| RTECS | UE5550000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933330000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 1 Inhalation Acute Tox. 2 Oral STOT SE 3 |
| Hazardous Substances Data | 437-38-7(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 18 mg/kg JPPMAB 25,929,73 |



![4-PIPERIDINECARBOXYLIC ACID, 4-[(1-OXOPROPYL)PHENYLAMINO]](https://img.chemicalbook.com/CAS/GIF/186022-53-7.gif)