S663078
Diisooctylthiophosphinic acid , technical,~85%(T) , 132767-86-3
| Pack Size | Price | Stock | Quantity |
| 100ML | RMB788.49 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 361.0±25.0 °C(Predicted) |
| Density | 0.93 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 96 °C |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| form | Oil |
| pka | 4.45±0.10(Predicted) |
| color | Pale Yellow to Pale Green |
| InChI | 1S/C16H35OPS/c1-13(9-15(3,4)5)11-18(17,19)12-14(2)10-16(6,7)8/h13-14H,9-12H2,1-8H3,(H,17,19) |
| InChIKey | KUYLHALFMPOMKK-UHFFFAOYSA-N |
| SMILES | CC(CC(C)(C)C)CP(S)(=O)CC(C)CC(C)(C)C |
| EPA Substance Registry System | Phosphinothioic acid, bis(2,4,4-trimethylpentyl)- (132767-86-3) |
Description and Uses
Diisooctylthiophosphinic Acid is a cyanex 302 metal complex with antibacterial and antifungal activities.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |





