S680578
(1R,2R,3R,5S)-(?)-Isopinocampheylamine , 95% , 69460-11-3
Synonym(s):
(−)-Isopinocampheylamine;(1R,2R,3R,5S)-3-Pinanamine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB431.07 | In Stock |
|
| 5g | RMB1844.58 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250 °C |
| Boiling point: | 90 °C18 mm Hg(lit.) |
| Density | 0.914 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 162 °F |
| storage temp. | 2-8°C, protect from light |
| pka | 11.03±0.60(Predicted) |
| form | Liquid |
| color | Colorless to yellow |
| optical activity | [α]21/D 42°, neat |
| InChI | 1S/C10H19N/c1-6-8-4-7(5-9(6)11)10(8,2)3/h6-9H,4-5,11H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | VPTSZLVPZCTAHZ-BZNPZCIMSA-N |
| SMILES | C[C@H]1[C@H](N)CC2CC1C2(C)C |
Description and Uses
(1R,2R,3R,5S)-(-)-Isopinocampheylamine can be used to treat conditions associated with STING activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





