S714278
6-Chloro-3-formyl-7-methylchromone , 98% , 64481-12-5
Synonym(s):
6-Chloro-7-methyl-4-oxo-4H-1-benzopyran-3-carboxaldehyde
| Pack Size | Price | Stock | Quantity |
| 1g | RMB267.37 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-185 °C(lit.) |
| Boiling point: | 380.9±42.0 °C(Predicted) |
| Density | 1.485±0.06 g/cm3(Predicted) |
| InChI | 1S/C11H7ClO3/c1-6-2-10-8(3-9(6)12)11(14)7(4-13)5-15-10/h2-5H,1H3 |
| InChIKey | NULJNFUEBPQUNB-UHFFFAOYSA-N |
| SMILES | Cc1cc2OC=C(C=O)C(=O)c2cc1Cl |
| CAS DataBase Reference | 64481-12-5(CAS DataBase Reference) |
Description and Uses
6-Chloro-3-formyl-7-methylchromone is the suitable reagent used in a study to investigate the multidrug resistabnce reversal by some 3- formylchromones in human colon cancer and mouse lymphoma cells transfected with the human MDR1 gene. It is the suitable reagent used in the synthesis of uridine-based library.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
