S717279
Tetrabutylammonium nitrite , ≥97.0%(NT) , 26501-54-2
CAS NO.:26501-54-2
Empirical Formula: C16H36N2O2
Molecular Weight: 288.47
MDL number: MFCD00043223
EINECS: 247-749-1
| Pack Size | Price | Stock | Quantity |
| 10g | RMB849.51 | In Stock |
|
| 50g | RMB3503.65 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-103 °C |
| form | crystals |
| BRN | 6285720 |
| InChI | 1S/C16H36N.HNO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1-3/h5-16H2,1-4H3;(H,2,3)/q+1;/p-1 |
| InChIKey | SHRKDVQQQPFSIY-UHFFFAOYSA-M |
| SMILES | [O-]N=O.CCCC[N+](CCCC)(CCCC)CCCC |
Description and Uses
Tetrabutylammonium nitrite is a tosylate salt. It reversibly binds to copper ions, forming a copper complex that is activated by the presence of nitroalkanes. The binding of tetrabutylammonium nitrite to glycosidic bonds in sugar residues, such as the hemoglobin molecule, leads to the formation of reactive oxygen species (ROS), which are responsible for cell damage. It has been shown to reduce infarct size and improve cardiac function in animal models following ischemic reperfusion injury. This compound also has antioxidant properties due to its ability to scavenge ROS and protect against oxidative stress.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




