PRODUCT Properties
| form | solution |
| BRN | 6785584 |
| InChI | InChI=1S/C20H44N.H2O/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;/h5-20H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | JVOPCCBEQRRLOJ-UHFFFAOYSA-M |
| SMILES | [N+](CCCCC)(CCCCC)(CCCCC)CCCCC.[OH-] |
Description and Uses
Tetrapentylammonium hydroxide can be used:
- As a model compound in the studies of the effects of quaternary ammonium salts on the formation of clathrate hydrates of methane.
- To maintain the pH of the aqueous phase to study the adsorption dynamics of nanoparticles at fluid interfaces.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3267 8/PG 2 |
| WGK Germany | 3 |
| F | 10-34 |
