S726179
α,β-Thujone , technical,~70%α-thujonebasis,~10%β-thujonebasis , 76231-76-0
Synonym(s):
(−)-1-Isopropyl-4-methylbicyclo[3.1.0]hexan-3-one
| Pack Size | Price | Stock | Quantity |
| 10ml | RMB642.78 | In Stock |
|
| 50ml | RMB2448.50 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 84-86 °C/17 mmHg (lit.) |
| Density | 0.925 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.455(lit.) |
| Flash point: | 64 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | 1S/2C10H16O/c2*1-6(2)10-4-8(10)7(3)9(11)5-10/h2*6-8H,4-5H2,1-3H3/t7-,8+,10-;7-,8-,10+/m01/s1 |
| InChIKey | AKPBIVZAUPVDMO-APEKEWONSA-N |
| SMILES | CC(C)[C@@]12C[C@@H]1[C@@H](C)C(=O)C2.CC(C)[C@@]34C[C@@H]3[C@H](C)C(=O)C4 |
Description and Uses
α,β-Thujone is a component of the essential oil of Pistacia vera L. It is also used as as a reactant in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38-42/43 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 76231-76-0(Hazardous Substances Data) |
