S7292327
≥95% , 23570-43-6
CAS NO.：23570-43-6
Empirical Formula: C36H24Cl2N6Ru
Molecular Weight: 712.59
MDL number: MFCD00061374
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB553.31 | In Stock |
|
| 250mg | RMB922.74 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| storage temp. | RT, protect from light, stored under nitrogen |
| form | powder or crystals |
| Appearance | Brown to dark brown Solid |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/3C12H8N2.2ClH.Ru/c3*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;;/h3*1-8H;2*1H;/q;;;;;+2/p-2 |
| InChIKey | UWXWBVKIJZGXQL-UHFFFAOYSA-L |
| SMILES | [Ru+2]951([NH]%10=C%11C%12=[NH]9C=CC=C%12C=CC%11=CC=C%10)([NH]6=C7C8=[NH]5C=CC=C8C=CC7=CC=C6)[NH]2=C3C4=[NH]1C=CC=C4C=CC3=CC=C2.[Cl-].[Cl-] |
Description and Uses
[Ru(phen)3]Cl2 is a cyclometalated ruthenium complex that can be used in visible light mediated photocatalytic organic transformations.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H413 |
| Precautionary statements | P501-P273-P270-P264-P301+P312+P330 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
