S743578
98atom%D , 38701-73-4
Synonym(s):
1,1,1,3,3,3-Hexafluoro-2-propan(ol-d)
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1114.74 | In Stock |
|
| 25g | RMB5378.82 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ?4 °C (lit.) |
| Boiling point: | 59 °C (lit.) |
| Density | 1.605 g/mL at 25 °C (lit.) |
| refractive index | n |
| InChI | InChI=1S/C3H2F6O/c4-2(5,6)1(10)3(7,8)9/h1,10H |
| InChIKey | BYEAHWXPCBROCE-UHFFFAOYSA-N |
| SMILES | C(O[H])(C(F)(F)F)C(F)(F)F |
| CAS Number Unlabeled | 920-66-1 |
Description and Uses
1,1,1,3,3,3-Hexafluoro-2-propanol-OD(HFIP-OD) is the deuterated form of 1,1,1,3,3,3-Hexafluoro-2-propanol. It isused as an NMR solvent in organic chemistry and biochemistry for studying smallmolecules.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H361-H373 |
| Precautionary statements | P202-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Central nervous system |
| Hazard Codes | C |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 26-27-28-36/37/39 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Repr. 2 Skin Corr. 1A STOT RE 2 Oral |






