PRODUCT Properties
| Melting point: | 178-182 °C |
| Boiling point: | 419.6±35.0 °C(Predicted) |
| Density | 1.688±0.06 g/cm3(Predicted) |
| pka | pK1:1.62 (25°C) |
| BRN | 1983247 |
| InChI | 1S/C7H4N2O6/c10-7(11)5-3-4(8(12)13)1-2-6(5)9(14)15/h1-3H,(H,10,11) |
| InChIKey | YKMDNKRCCODWMG-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(ccc1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 610-28-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2,5-dinitro- (610-28-6) |
Description and Uses
2,5-Dinitrobenzoic acid is a benzoic acid derivative. Its proton, deuteron and proton spin-lattice relaxation times have been evaluated by using Schrödinger wave equation.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | DG9140550 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
