S7784748
Salicylicacid-d4 , 100 μg/mLinacetonitrile,ampuleof1 mL,certifiedreferencematerial,Cerilliant , 78646-17-0
CAS NO.:78646-17-0
Empirical Formula: C7H2D4O3
Molecular Weight: 142.15
MDL number: MFCD06658892
EINECS: 200-835-2
| Pack Size | Price | Stock | Quantity |
| 1mL | RMB1415.03 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-158°C |
| Flash point: | 2℃ |
| storage temp. | Refrigerator |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)/i1D,2D,3D,4D |
| InChIKey | YGSDEFSMJLZEOE-RHQRLBAQSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(C(O)=O)c(O)c1[2H] |
| CAS DataBase Reference | 78646-17-0 |
| CAS Number Unlabeled | 69-72-7 |
Description and Uses
Salicylic Acid-d4 is a deuterium labeled acetylsalicylic acid impurity B used in organic synthesis.
Labelled Salicylic acid (S088125). Salicylic Acid is an impurity of Acetylsalicylic Acid (A187780). Labelled Acetylsalicylic Acid EP Impurity C.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 16-36/37 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |





