S783378
N,N,N′,N′-Tetraethyldiethylenetriamine , technicalgrade,90% , 123-12-6
CAS NO.:123-12-6
Empirical Formula: C12H29N3
Molecular Weight: 215.38
MDL number: MFCD00039880
EINECS: 204-603-1
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB489.30 | In Stock |
|
| 25ml | RMB1716.61 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 130-135 °C(lit.) |
| Density | 0.837 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 208 °F |
| pka | 10.45±0.25(Predicted) |
| form | liquid |
| InChI | InChI=1S/C12H29N3/c1-5-14(6-2)11-9-13-10-12-15(7-3)8-4/h13H,5-12H2,1-4H3 |
| InChIKey | UICCSKORMGVRCB-UHFFFAOYSA-N |
| SMILES | C(N(CC)CC)CNCCN(CC)CC |
| EPA Substance Registry System | 1,2-Ethanediamine, N'-[2-(diethylamino)ethyl]-N,N-diethyl- (123-12-6) |
Description and Uses
N,N,N',N'-tetraethyldiethylenetriamine (TEDETA) has been used in the following studies:
- As N-substituted ethylenediamine ligand in the synthesis of [Ni(Et4dien)(NO2)2] (Et4dien=N,N,N′,N′-tetraethyldiethylenetriamine).
- As a reagent in the synthesis of adamantanyl connector, (2-(1-carbamoylmethyladamantane)di(ethyl(diethylmethylammonium))dichloride).
- As a reagent in the synthesis of aminated macroligand.
- As a reagent in the synthesis of precipiton ligand.
- As a multimodal ligand in the synthesis of P(S-DVB)-g-P(S-GMA)- TEDETA beads (poly(styrene-divinylbenzene)-graft-poly(styrene-glycidylmethacrylate)).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2735 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 ivn-mus: 180 mg/kg CSLNX* NX#01684 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






