S787279
≥80%(HPLC),≥80%(spectrophotometricassay) , 3493-13-8
Synonym(s):
AdoMet;SAM
CAS NO.:3493-13-8
Empirical Formula: C15H23IN6O5S
Molecular Weight: 526.35
MDL number: MFCD00043192
EINECS: 222-486-5
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB625.80 | In Stock |
|
| 25mg | RMB1784.49 | In Stock |
|
| 100mg | RMB5522.26 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | H2O: 100 mg/mL |
| form | powder |
| color | white to off-white |
| Water Solubility | H2O: 100mg/mL |
| BRN | 4120787 |
| InChIKey | XQMWYLXPEGFCFT-JKRVOTFBNA-N |
| SMILES | N1(C=NC2C(N)=NC=NC1=2)[C@H]1[C@H](O)[C@H](O)[C@@H](C[S+](C)CC[C@H](N)C(=O)O)O1.[I-] |&1:10,11,13,15,21,r| |
Description and Uses
S-(5′-Adenosyl)-L-methionine (SAM, AdoMet) is used as a primary methyl donor molecule in mammalian cell culture and the first step metabolite in methionine biosynthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| PPE | Eyeshields, Faceshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 8-10-23 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |





![5'-[[(3S)-3-Amino-3-carboxypropyl]methylsulfonio]-5'-deoxy-adenosine chloride](https://img.chemicalbook.com/CAS/GIF/24346-00-7.gif)