S8091628
8-(2-Aminoethylamino)-1-naphthalenesulfonic acid , ~85% , 50402-57-8
Synonym(s):
1,8-EDANS
CAS NO.:50402-57-8
Empirical Formula: C12H14N2O3S
Molecular Weight: 266.32
MDL number: MFCD00055909
EINECS: 256-576-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB598.50 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 345-350°C dec. |
| Density | 1.432±0.06 g/cm3(Predicted) |
| solubility | DMSO |
| form | Powder |
| pka | -0.54±0.40(Predicted) |
| color | Off-White |
| InChI | 1S/C12H14N2O3S/c13-7-8-14-10-5-1-3-9-4-2-6-11(12(9)10)18(15,16)17/h1-6,14H,7-8,13H2,(H,15,16,17) |
| InChIKey | XCNDHKWVELDQPO-UHFFFAOYSA-N |
| SMILES | NCCNc1cccc2cccc(c12)S(O)(=O)=O |
| CAS DataBase Reference | 50402-57-8 |
Description and Uses
A fluorescent reagent with a terminal amine for derivatization
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |




