PRODUCT Properties
| Melting point: | 89-91 °C(lit.) |
| Boiling point: | 256 °C(lit.) |
| Flash point: | 145℃ |
| pka | 6.953(at 25℃) |
| form | powder |
| InChI | 1S/C3H4N2/c1-2-5-3-4-1/h1-3H,(H,4,5)/i1D,2D,3D/hD |
| InChIKey | RAXXELZNTBOGNW-MSWVZFBTSA-N |
| SMILES | [2H]c1nc([2H])n([2H])c1[2H] |
| CAS Number Unlabeled | 288-32-4 |
Description and Uses
Imidazole-d4 may be used in the synthesis of 1-ethylimidazole-d8 by reacting with ethyl iodide-d5 and 1-butylimidazole-d12 by reacting with butyl iodide-d9. These compounds form the precursors for the preparation of perdeuterated cellulose solvents, 1-ethyl-3-methylimidazolium acetate (EMIM-OAc-d14) and 1-butyl-3-methylimidazolium acetate (BMIM-OAc-d18).
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H314-H360D |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C,T |
| Risk Statements | 22-34-61 |
| Safety Statements | 22-26-36/37/39-45-53 |
| RIDADR | UN 3259 8/PG 2 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Repr. 1B Skin Corr. 1B |
