PRODUCT Properties
| Melting point: | 40-50 °C(lit.) |
| Boiling point: | 159-160 °C(lit.) |
| Density | 0.839 g/mL at 25 °C(lit.) |
| refractive index | 1.4562 (estimate) |
| Flash point: | 98 °F |
| solubility | Benzene (Slightly), Chloroform (Slightly), |
| form | Solid |
| color | White to Off-White Waxy |
| Odor | at 10.00 % in dipropylene glycol. fresh herbal woody fir camphor |
| Odor Type | woody |
| biological source | synthetic |
| optical activity | [α]20/D +16°, c = 4 in ethanol |
| Major Application | flavors and fragrances |
| InChI | 1S/C10H16/c1-7-8-4-5-9(6-8)10(7,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9+/m0/s1 |
| InChIKey | CRPUJAZIXJMDBK-DTWKUNHWSA-N |
| SMILES | CC1(C)[C@@H]2CC[C@@H](C2)C1=C |
| LogP | 4.220 |
| EPA Substance Registry System | Bicyclo[2.2.1]heptane, 2,2-dimethyl-3-methylene-, (1R,4S)- (5794-03-6) |
Description and Uses
(+)-Camphene is part of a mixture which is responsible for the anti-inflammatory effect of essential oil from Citrus aurantium L. var. amara Engl.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Danger |
| Hazard statements | H228 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-33 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 1 |
