S881478
3,5-Bis(trifluoromethyl)hydrocinnamic acid , 97% , 181772-16-7
Synonym(s):
3-[3,5-Bis(trifluoromethyl)phenyl]propionic acid
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2518.12 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-73 °C(lit.) |
| Boiling point: | 247℃ |
| Density | 1.427 |
| Flash point: | 103℃ |
| pka | 4.45±0.10(Predicted) |
| form | solid |
| InChI | 1S/C11H8F6O2/c12-10(13,14)7-3-6(1-2-9(18)19)4-8(5-7)11(15,16)17/h3-5H,1-2H2,(H,18,19) |
| InChIKey | LISLXJGPJUAEHU-UHFFFAOYSA-N |
| SMILES | OC(=O)CCc1cc(cc(c1)C(F)(F)F)C(F)(F)F |
Description and Uses
3,5-Bis(trifluoroMethyl)hydrocinnaMic acid can be used to prepare novel biologically active amides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2918999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




