S883278
(Vinylbenzyl)trimethylammonium chloride , 99% , 26616-35-3
Synonym(s):
(ar-Vinylbenzyl)trimethylammonium chloride
CAS NO.：26616-35-3
Empirical Formula: C12H18ClN
Molecular Weight: 211.73
MDL number: MFCD00080690
EINECS: 247-850-0
| Pack Size | Price | Stock | Quantity |
| 100g | RMB2320.35 | In Stock |
|
| 250g | RMB3240.06 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240 °C (dec.)(lit.) |
| Boiling point: | 344.02°C (rough estimate) |
| Density | 1.0500 (rough estimate) |
| refractive index | 1.5868 (estimate) |
| storage temp. | 0-6°C |
| form | Crystalline Powder and Chunks |
| color | White to yellow |
| BRN | 3730835 |
| InChI | InChI=1S/C12H18N.ClH/c1-5-11-6-8-12(9-7-11)10-13(2,3)4;/h5-9H,1,10H2,2-4H3;1H/q+1;/p-1 |
| InChIKey | TVXNKQRAZONMHJ-UHFFFAOYSA-M |
| SMILES | C1(C[N+](C)(C)C)=CC=C(C=C)C=C1.[Cl-] |
| EPA Substance Registry System | Benzenemethanaminium, ar-ethenyl-N,N,N-trimethyl-, chloride (26616-35-3) |
Description and Uses
(Vinylbenzyl)trimethylammonium chloride (VBTA) can be used as a monomer:
- To synthesize the poly(AMA-DVB-VBTA) monolith columns, which are used for solid-phase microextraction in analytical chemistry.
- To prepare an anion exchange membrane for a lignin oxidizing electrolyzer. VBTA provides the anion exchange functionality to the copolymer membrane, which allows for the selective transport of anions across the membrane
- Poly[oligo(ethylene glycol) methacrylate]-b-based nanostructures for encapsulating magnetic nanoparticles and DNA.
- Nano-sized polyelectrolyte complexes.
- Homo and block copolymers of poly(VBTMAC) for non-viral DNA delivery systems.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29239000 |
