S885878
1-(3-Bromopropyl)-2,2,5,5-tetramethyl-1-aza-2,5-disilacyclopentane , 97% , 95091-93-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1655.75 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80 °C/0.5 mmHg(lit.) |
| Density | 1.126 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.484(lit.) |
| Flash point: | 35 °C |
| pka | 13.41±0.20(Predicted) |
| InChI | 1S/C9H22BrNSi2/c1-12(2)8-9-13(3,4)11(12)7-5-6-10/h5-9H2,1-4H3 |
| InChIKey | BKBUBAVZGMRPAK-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1CCCBr |
Description and Uses
1-(3-Bromopropyl)-2,2,5,5-tetramethyl-1-aza-2,5-disilacyclopentane may be used for the synthesis of PFS-b-PZLys [PFS = Polyferrocenylsilane, PZLys = Poly(epsilon-benzyloxycarbonyl-L-lysine)] block copolymers.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P240-P241-P280-P303+P361+P353-P370+P378 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
